C9H19NO5S — CID 96842470
tert-butyl (2S)-2-(aminomethyl)-3-methylsulfonyloxypropanoate (PubChem CID 96842470) has the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. Its IUPAC name is tert-butyl (2S)-2-(aminomethyl)-3-methylsulfonyloxypropanoate.
| Compound Name | tert-butyl (2S)-2-(aminomethyl)-3-methylsulfonyloxypropanoate |
|---|---|
| PubChem CID | 96842470 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | tert-butyl (2S)-2-(aminomethyl)-3-methylsulfonyloxypropanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CN)COS(C)(=O)=O |
| InChI | InChI=1S/C9H19NO5S/c1-9(2,3)15-8(11)7(5-10)6-14-16(4,12)13/h7H,5-6,10H2,1-4H3/t7-/m0/s1 |
| InChIKey | VOXVBKJARYGHNC-ZETCQYMHSA-N |
| XLogP | -0.12 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|