C13H25NO7S — CID 86644348
5-O-tert-butyl 1-O-ethyl (2R)-2-amino-4-(methylsulfonyloxymethyl)pentanedioate (PubChem CID 86644348) has the molecular formula C13H25NO7S and a molecular weight of 339.41 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-ethyl (2R)-2-amino-4-(methylsulfonyloxymethyl)pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-ethyl (2R)-2-amino-4-(methylsulfonyloxymethyl)pentanedioate |
|---|---|
| PubChem CID | 86644348 |
| Molecular Formula | C13H25NO7S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 5-O-tert-butyl 1-O-ethyl (2R)-2-amino-4-(methylsulfonyloxymethyl)pentanedioate |
| SMILES | CCOC(=O)[C@H](N)CC(COS(C)(=O)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO7S/c1-6-19-12(16)10(14)7-9(8-20-22(5,17)18)11(15)21-13(2,3)4/h9-10H,6-8,14H2,1-5H3/t9?,10-/m1/s1 |
| InChIKey | NDISQTRCCVHKKV-QVDQXJPCSA-N |
| XLogP | 0.20 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|