C24H34ClNO7S — CID 123439952
ethyl 5-[4-(4-chlorobuta-1,3-dien-2-yl)phenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfonyloxymethyl)pentanoate (PubChem CID 123439952) has the molecular formula C24H34ClNO7S and a molecular weight of 516.06 g/mol. Its IUPAC name is ethyl 5-[4-(4-chlorobuta-1,3-dien-2-yl)phenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfonyloxymethyl)pentanoate.
| Compound Name | ethyl 5-[4-(4-chlorobuta-1,3-dien-2-yl)phenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfonyloxymethyl)pentanoate |
|---|---|
| PubChem CID | 123439952 |
| Molecular Formula | C24H34ClNO7S |
| Molecular Weight | 516.06 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | ethyl 5-[4-(4-chlorobuta-1,3-dien-2-yl)phenyl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(methylsulfonyloxymethyl)pentanoate |
| SMILES | C=C(C=CCl)c1ccc(CC(CC(COS(C)(=O)=O)C(=O)OCC)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H34ClNO7S/c1-7-31-22(27)20(16-32-34(6,29)30)15-21(26-23(28)33-24(3,4)5)14-18-8-10-19(11-9-18)17(2)12-13-25/h8-13,20-21H,2,7,14-16H2,1,3-6H3,(H,26,28) |
| InChIKey | MBOQVCXZWUURIX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.06 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|