C27H37NO7S — CID 126684518
ethyl (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylsulfonyloxyethyl)-5-(4-phenylphenyl)pentanoate (PubChem CID 126684518) has the molecular formula C27H37NO7S and a molecular weight of 519.66 g/mol. Its IUPAC name is ethyl (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylsulfonyloxyethyl)-5-(4-phenylphenyl)pentanoate.
| Compound Name | ethyl (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylsulfonyloxyethyl)-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 126684518 |
| Molecular Formula | C27H37NO7S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | ethyl (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylsulfonyloxyethyl)-5-(4-phenylphenyl)pentanoate |
| SMILES | CCOC(=O)[C@H](CCOS(C)(=O)=O)C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H37NO7S/c1-6-33-25(29)23(16-17-34-36(5,31)32)19-24(28-26(30)35-27(2,3)4)18-20-12-14-22(15-13-20)21-10-8-7-9-11-21/h7-15,23-24H,6,16-19H2,1-5H3,(H,28,30)/t23-,24-/m1/s1 |
| InChIKey | CHLLQSNCWROJPA-DNQXCXABSA-N |
| XLogP | 4.73 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|