C21H34N2O5 — CID 142205294
ethyl 2-(2-methoxyethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate (PubChem CID 142205294) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is ethyl 2-(2-methoxyethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate.
| Compound Name | ethyl 2-(2-methoxyethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate |
|---|---|
| PubChem CID | 142205294 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethyl 2-(2-methoxyethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoate |
| SMILES | CCOC(=O)C(CC(Cc1ccccc1)NC(=O)OC(C)(C)C)NCCOC |
| InChI | InChI=1S/C21H34N2O5/c1-6-27-19(24)18(22-12-13-26-5)15-17(14-16-10-8-7-9-11-16)23-20(25)28-21(2,3)4/h7-11,17-18,22H,6,12-15H2,1-5H3,(H,23,25) |
| InChIKey | ZVZWCQIGYMBZLI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|