C19H30N2O6 — CID 11269056
(2R,3R,4S)-3-hydroxy-2-(2-methoxyethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid (PubChem CID 11269056) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2R,3R,4S)-3-hydroxy-2-(2-methoxyethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid.
| Compound Name | (2R,3R,4S)-3-hydroxy-2-(2-methoxyethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 11269056 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (2R,3R,4S)-3-hydroxy-2-(2-methoxyethylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid |
| SMILES | COCCN[C@@H](C(=O)O)[C@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O6/c1-19(2,3)27-18(25)21-14(12-13-8-6-5-7-9-13)16(22)15(17(23)24)20-10-11-26-4/h5-9,14-16,20,22H,10-12H2,1-4H3,(H,21,25)(H,23,24)/t14-,15+,16+/m0/s1 |
| InChIKey | ABEGZCDKKDQNRL-ARFHVFGLSA-N |
| XLogP | 1.17 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|