C24H27FN4O6S — CID 118259134
ethyl (2R,4S)-5-[4-(3-fluorophenyl)phenyl]-2-(methylsulfonyloxymethyl)-4-(2H-triazole-4-carbonylamino)pentanoate (PubChem CID 118259134) has the molecular formula C24H27FN4O6S and a molecular weight of 518.57 g/mol. Its IUPAC name is ethyl (2R,4S)-5-[4-(3-fluorophenyl)phenyl]-2-(methylsulfonyloxymethyl)-4-(2H-triazole-4-carbonylamino)pentanoate.
| Compound Name | ethyl (2R,4S)-5-[4-(3-fluorophenyl)phenyl]-2-(methylsulfonyloxymethyl)-4-(2H-triazole-4-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 118259134 |
| Molecular Formula | C24H27FN4O6S |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | ethyl (2R,4S)-5-[4-(3-fluorophenyl)phenyl]-2-(methylsulfonyloxymethyl)-4-(2H-triazole-4-carbonylamino)pentanoate |
| SMILES | CCOC(=O)[C@@H](COS(C)(=O)=O)C[C@@H](Cc1ccc(-c2cccc(F)c2)cc1)NC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C24H27FN4O6S/c1-3-34-24(31)19(15-35-36(2,32)33)13-21(27-23(30)22-14-26-29-28-22)11-16-7-9-17(10-8-16)18-5-4-6-20(25)12-18/h4-10,12,14,19,21H,3,11,13,15H2,1-2H3,(H,27,30)(H,26,28,29)/t19-,21-/m1/s1 |
| InChIKey | CZPMZIOKVCUYRK-TZIWHRDSSA-N |
| XLogP | 2.50 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|