C26H31ClFN5O4 — CID 129147696
ethyl (4S)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[(2-methoxyethylamino)methyl]-4-(2H-triazole-4-carbonylamino)pentanoate (PubChem CID 129147696) has the molecular formula C26H31ClFN5O4 and a molecular weight of 532.02 g/mol. Its IUPAC name is ethyl (4S)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[(2-methoxyethylamino)methyl]-4-(2H-triazole-4-carbonylamino)pentanoate.
| Compound Name | ethyl (4S)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[(2-methoxyethylamino)methyl]-4-(2H-triazole-4-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 129147696 |
| Molecular Formula | C26H31ClFN5O4 |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | ethyl (4S)-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[(2-methoxyethylamino)methyl]-4-(2H-triazole-4-carbonylamino)pentanoate |
| SMILES | CCOC(=O)C(CNCCOC)C[C@@H](Cc1ccc(-c2cc(Cl)ccc2F)cc1)NC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C26H31ClFN5O4/c1-3-37-26(35)19(15-29-10-11-36-2)13-21(31-25(34)24-16-30-33-32-24)12-17-4-6-18(7-5-17)22-14-20(27)8-9-23(22)28/h4-9,14,16,19,21,29H,3,10-13,15H2,1-2H3,(H,31,34)(H,30,32,33)/t19?,21-/m1/s1 |
| InChIKey | KGPFLXDKVJAIGI-VGAJERRHSA-N |
| XLogP | 3.41 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|