C23H25ClFN5O4 — CID 123723008
5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[(2-hydroxyethylamino)methyl]-4-(2H-triazole-4-carbonylamino)pentanoic acid (PubChem CID 123723008) has the molecular formula C23H25ClFN5O4 and a molecular weight of 489.94 g/mol. Its IUPAC name is 5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[(2-hydroxyethylamino)methyl]-4-(2H-triazole-4-carbonylamino)pentanoic acid.
| Compound Name | 5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[(2-hydroxyethylamino)methyl]-4-(2H-triazole-4-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 123723008 |
| Molecular Formula | C23H25ClFN5O4 |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[(2-hydroxyethylamino)methyl]-4-(2H-triazole-4-carbonylamino)pentanoic acid |
| SMILES | O=C(NC(Cc1ccc(-c2cc(Cl)ccc2F)cc1)CC(CNCCO)C(=O)O)c1cn[nH]n1 |
| InChI | InChI=1S/C23H25ClFN5O4/c24-17-5-6-20(25)19(11-17)15-3-1-14(2-4-15)9-18(28-22(32)21-13-27-30-29-21)10-16(23(33)34)12-26-7-8-31/h1-6,11,13,16,18,26,31H,7-10,12H2,(H,28,32)(H,33,34)(H,27,29,30) |
| InChIKey | KKFBNTBZPDDCOO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|