C9H17NO2 — CID 124671307
tert-butyl (2R)-3,3-dimethylaziridine-2-carboxylate (PubChem CID 124671307) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is tert-butyl (2R)-3,3-dimethylaziridine-2-carboxylate.
| Compound Name | tert-butyl (2R)-3,3-dimethylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 124671307 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | tert-butyl (2R)-3,3-dimethylaziridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1NC1(C)C |
| InChI | InChI=1S/C9H17NO2/c1-8(2,3)12-7(11)6-9(4,5)10-6/h6,10H,1-5H3/t6-/m0/s1 |
| InChIKey | JGAPPPNNQWYENS-LURJTMIESA-N |
| XLogP | 1.08 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|