C16H28O4 — CID 175257362
ditert-butyl 2-ethylcyclobutane-1,1-dicarboxylate (PubChem CID 175257362) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is ditert-butyl 2-ethylcyclobutane-1,1-dicarboxylate.
| Compound Name | ditert-butyl 2-ethylcyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 175257362 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ditert-butyl 2-ethylcyclobutane-1,1-dicarboxylate |
| SMILES | CCC1CCC1(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28O4/c1-8-11-9-10-16(11,12(17)19-14(2,3)4)13(18)20-15(5,6)7/h11H,8-10H2,1-7H3 |
| InChIKey | PXGTYCQBLFRPNZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|