About tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate
tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate (PubChem CID 15934592) has the molecular formula C14H17NO5
and a molecular weight of 279.29 g/mol. Its IUPAC name is tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate |
| PubChem CID | 15934592 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC2(C=CC(=O)C=C2)OC1=O |
| InChI | InChI=1S/C14H17NO5/c1-13(2,3)20-12(18)15-10-8-14(19-11(10)17)6-4-9(16)5-7-14/h4-7,10H,8H2,1-3H3,(H,15,18)/t10-/m0/s1 |
| InChIKey | PAKKPHYCVABQPO-JTQLQIEISA-N |
| XLogP | 1.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate (CID 15934592) is tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate is CC(C)(C)OC(=O)N[C@H]1CC2(C=CC(=O)C=C2)OC1=O.
What is the InChIKey of tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate?
The InChIKey is PAKKPHYCVABQPO-JTQLQIEISA-N. The full InChI is InChI=1S/C14H17NO5/c1-13(2,3)20-12(18)15-10-8-14(19-11(10)17)6-4-9(16)5-7-14/h4-7,10H,8H2,1-3H3,(H,15,18)/t10-/m0/s1.
What are the key properties of tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate?
tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate has a molecular weight of 279.29 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3S)-2,8-dioxo-1-oxaspiro[4.5]deca-6,9-dien-3-yl]carbamate is sourced from PubChem (CID 15934592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).