About (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate
(6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate (PubChem CID 14237481) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate.
Analyze (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate?
The IUPAC name of (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate (CID 14237481) is (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate.
What is the SMILES notation for (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate?
The canonical SMILES for (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate is CC(=O)OC12C=CC(=O)CC1OCC2.
What is the InChIKey of (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate?
The InChIKey is PZOSJQZCHVKTQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-7(11)14-10-3-2-8(12)6-9(10)13-5-4-10/h2-3,9H,4-6H2,1H3.
What are the key properties of (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate?
(6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate has a molecular weight of 196.20 g/mol, XLogP of 0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) acetate is sourced from PubChem (CID 14237481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).