C14H20O4 — CID 14237483
(6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) hexanoate (PubChem CID 14237483) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) hexanoate.
| Compound Name | (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) hexanoate |
|---|---|
| PubChem CID | 14237483 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (6-oxo-2,3,7,7a-tetrahydro-1-benzofuran-3a-yl) hexanoate |
| SMILES | CCCCCC(=O)OC12C=CC(=O)CC1OCC2 |
| InChI | InChI=1S/C14H20O4/c1-2-3-4-5-13(16)18-14-7-6-11(15)10-12(14)17-9-8-14/h6-7,12H,2-5,8-10H2,1H3 |
| InChIKey | IAHVKYZPDVSMEF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|