C25H39NO5 — CID 144829544
N-cyclohexylcyclohexanamine;ethyl 4-(cyclopropanecarbonyl)-3,5-dioxocyclohexane-1-carboxylate (PubChem CID 144829544) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;ethyl 4-(cyclopropanecarbonyl)-3,5-dioxocyclohexane-1-carboxylate.
| Compound Name | N-cyclohexylcyclohexanamine;ethyl 4-(cyclopropanecarbonyl)-3,5-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 144829544 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | N-cyclohexylcyclohexanamine;ethyl 4-(cyclopropanecarbonyl)-3,5-dioxocyclohexane-1-carboxylate |
| SMILES | C1CCC(NC2CCCCC2)CC1.CCOC(=O)C1CC(=O)C(C(=O)C2CC2)C(=O)C1 |
| InChI | InChI=1S/C13H16O5.C12H23N/c1-2-18-13(17)8-5-9(14)11(10(15)6-8)12(16)7-3-4-7;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h7-8,11H,2-6H2,1H3;11-13H,1-10H2 |
| InChIKey | NKNLNJYTLBAPOA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|