C12H14INO2 — CID 156536085
ethyl 5-amino-6-iodo-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 156536085) has the molecular formula C12H14INO2 and a molecular weight of 331.15 g/mol. Its IUPAC name is ethyl 5-amino-6-iodo-2,3-dihydro-1H-indene-2-carboxylate.
| Compound Name | ethyl 5-amino-6-iodo-2,3-dihydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 156536085 |
| Molecular Formula | C12H14INO2 |
| Molecular Weight | 331.15 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | ethyl 5-amino-6-iodo-2,3-dihydro-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)C1Cc2cc(N)c(I)cc2C1 |
| InChI | InChI=1S/C12H14INO2/c1-2-16-12(15)9-3-7-5-10(13)11(14)6-8(7)4-9/h5-6,9H,2-4,14H2,1H3 |
| InChIKey | HBVCCHPWUBXANO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.15 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|