C13H16O3 — CID 170903881
ethyl 8-methyl-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 170903881) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is ethyl 8-methyl-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | ethyl 8-methyl-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 170903881 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethyl 8-methyl-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1COc2c(C)cccc2C1 |
| InChI | InChI=1S/C13H16O3/c1-3-15-13(14)11-7-10-6-4-5-9(2)12(10)16-8-11/h4-6,11H,3,7-8H2,1-2H3 |
| InChIKey | BGTZQBCTSQPCOL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |