C19H25NO2 — CID 156548740
ethyl 6-amino-5-[(E)-2-cyclopropylprop-1-enyl]-4-methyl-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 156548740) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is ethyl 6-amino-5-[(E)-2-cyclopropylprop-1-enyl]-4-methyl-2,3-dihydro-1H-indene-2-carboxylate.
| Compound Name | ethyl 6-amino-5-[(E)-2-cyclopropylprop-1-enyl]-4-methyl-2,3-dihydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 156548740 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | ethyl 6-amino-5-[(E)-2-cyclopropylprop-1-enyl]-4-methyl-2,3-dihydro-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)C1Cc2cc(N)c(/C=C(\C)C3CC3)c(C)c2C1 |
| InChI | InChI=1S/C19H25NO2/c1-4-22-19(21)15-8-14-10-18(20)17(12(3)16(14)9-15)7-11(2)13-5-6-13/h7,10,13,15H,4-6,8-9,20H2,1-3H3/b11-7+ |
| InChIKey | MZCGBAIKCKSVLX-YRNVUSSQSA-N |
| XLogP | 3.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|