About cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate
cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate (PubChem CID 46214799) has the molecular formula C21H28O4
and a molecular weight of 344.45 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate |
| PubChem CID | 46214799 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(=O)C[C@@H]1C(=O)Cc1c(CC)cc(C)cc1CC |
| InChI | InChI=1S/C21H28O4/c1-5-14-8-13(4)9-15(6-2)17(14)12-20(23)18-10-16(22)11-19(18)21(24)25-7-3/h8-9,18-19H,5-7,10-12H2,1-4H3/t18-,19+/m0/s1 |
| InChIKey | JVJHPTPVZMREPO-RBUKOAKNSA-N |
| XLogP | 3.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate?
The IUPAC name of cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate (CID 46214799) is cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate?
The canonical SMILES for cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate is CCOC(=O)[C@@H]1CC(=O)C[C@@H]1C(=O)Cc1c(CC)cc(C)cc1CC.
What is the InChIKey of cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate?
The InChIKey is JVJHPTPVZMREPO-RBUKOAKNSA-N. The full InChI is InChI=1S/C21H28O4/c1-5-14-8-13(4)9-15(6-2)17(14)12-20(23)18-10-16(22)11-19(18)21(24)25-7-3/h8-9,18-19H,5-7,10-12H2,1-4H3/t18-,19+/m0/s1.
What are the key properties of cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate?
cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate has a molecular weight of 344.45 g/mol, XLogP of 3.39, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1R,2S)-2-[2-(2,6-diethyl-4-methylphenyl)acetyl]-4-oxocyclopentane-1-carboxylate is sourced from PubChem (CID 46214799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).