C23H28NO3P — CID 135033626
ethyl (Z)-3-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]pent-2-enoate (PubChem CID 135033626) has the molecular formula C23H28NO3P and a molecular weight of 397.46 g/mol. Its IUPAC name is ethyl (Z)-3-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]pent-2-enoate.
| Compound Name | ethyl (Z)-3-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 135033626 |
| Molecular Formula | C23H28NO3P |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | ethyl (Z)-3-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]pent-2-enoate |
| SMILES | CCOC(=O)/C=C(/CC)NP1(=O)[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H28NO3P/c1-3-20(17-23(25)27-4-2)24-28(26)21(18-11-7-5-8-12-18)15-16-22(28)19-13-9-6-10-14-19/h5-14,17,21-22H,3-4,15-16H2,1-2H3,(H,24,26)/b20-17-/t21-,22-/m0/s1 |
| InChIKey | KEXUCEGQBNEKEU-QWULRYHZSA-N |
| XLogP | 5.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|