C22H29BNO3P — CID 135033901
(2S,5S)-N-[(E)-4-boranyloxy-4-ethoxybut-3-en-2-yl]-1-oxo-2,5-diphenyl-1λ5-phospholan-1-amine (PubChem CID 135033901) has the molecular formula C22H29BNO3P and a molecular weight of 397.26 g/mol. Its IUPAC name is (2S,5S)-N-[(E)-4-boranyloxy-4-ethoxybut-3-en-2-yl]-1-oxo-2,5-diphenyl-1λ5-phospholan-1-amine.
| Compound Name | (2S,5S)-N-[(E)-4-boranyloxy-4-ethoxybut-3-en-2-yl]-1-oxo-2,5-diphenyl-1λ5-phospholan-1-amine |
|---|---|
| PubChem CID | 135033901 |
| Molecular Formula | C22H29BNO3P |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (2S,5S)-N-[(E)-4-boranyloxy-4-ethoxybut-3-en-2-yl]-1-oxo-2,5-diphenyl-1λ5-phospholan-1-amine |
| SMILES | BO/C(=C\C(C)NP1(=O)[C@H](c2ccccc2)CC[C@H]1c1ccccc1)OCC |
| InChI | InChI=1S/C22H29BNO3P/c1-3-26-22(27-23)16-17(2)24-28(25)20(18-10-6-4-7-11-18)14-15-21(28)19-12-8-5-9-13-19/h4-13,16-17,20-21H,3,14-15,23H2,1-2H3,(H,24,25)/b22-16-/t17?,20-,21-/m0/s1 |
| InChIKey | ZNPJUXGZMHJFTE-GWQVOWLSSA-N |
| XLogP | 4.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|