C15H20NO3P — CID 10756113
ethyl 2-[(1-oxo-2,5-dihydro-1λ5-phosphol-1-yl)amino]-3-phenylpropanoate (PubChem CID 10756113) has the molecular formula C15H20NO3P and a molecular weight of 293.30 g/mol. Its IUPAC name is ethyl 2-[(1-oxo-2,5-dihydro-1λ5-phosphol-1-yl)amino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[(1-oxo-2,5-dihydro-1λ5-phosphol-1-yl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10756113 |
| Molecular Formula | C15H20NO3P |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethyl 2-[(1-oxo-2,5-dihydro-1λ5-phosphol-1-yl)amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NP1(=O)CC=CC1 |
| InChI | InChI=1S/C15H20NO3P/c1-2-19-15(17)14(12-13-8-4-3-5-9-13)16-20(18)10-6-7-11-20/h3-9,14H,2,10-12H2,1H3,(H,16,18) |
| InChIKey | JEFMMGNDKZYOOY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|