C24H33N2O2P — CID 135033744
(3S)-N,N-diethyl-3-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]butanamide (PubChem CID 135033744) has the molecular formula C24H33N2O2P and a molecular weight of 412.51 g/mol. Its IUPAC name is (3S)-N,N-diethyl-3-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]butanamide.
| Compound Name | (3S)-N,N-diethyl-3-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]butanamide |
|---|---|
| PubChem CID | 135033744 |
| Molecular Formula | C24H33N2O2P |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (3S)-N,N-diethyl-3-[[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]amino]butanamide |
| SMILES | CCN(CC)C(=O)C[C@H](C)NP1(=O)[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H33N2O2P/c1-4-26(5-2)24(27)18-19(3)25-29(28)22(20-12-8-6-9-13-20)16-17-23(29)21-14-10-7-11-15-21/h6-15,19,22-23H,4-5,16-18H2,1-3H3,(H,25,28)/t19-,22-,23-/m0/s1 |
| InChIKey | HPXUQGIUSWPRCZ-VJBMBRPKSA-N |
| XLogP | 5.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|