C17H26N2O3 — CID 67914576
ethyl (3R,4S)-3-methoxy-4-(1-phenylethylamino)piperidine-1-carboxylate (PubChem CID 67914576) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is ethyl (3R,4S)-3-methoxy-4-(1-phenylethylamino)piperidine-1-carboxylate.
| Compound Name | ethyl (3R,4S)-3-methoxy-4-(1-phenylethylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67914576 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | ethyl (3R,4S)-3-methoxy-4-(1-phenylethylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@H](NC(C)c2ccccc2)[C@H](OC)C1 |
| InChI | InChI=1S/C17H26N2O3/c1-4-22-17(20)19-11-10-15(16(12-19)21-3)18-13(2)14-8-6-5-7-9-14/h5-9,13,15-16,18H,4,10-12H2,1-3H3/t13?,15-,16+/m0/s1 |
| InChIKey | HHGWCCKSZBPIKL-PXWJKWRZSA-N |
| XLogP | 2.58 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |