C34H46N4O8 — CID 135283675
bis[(3S,4R)-3-methoxy-4-[[(1R)-1-phenylethyl]amino]piperidine-1-carbonyl] butanedioate (PubChem CID 135283675) has the molecular formula C34H46N4O8 and a molecular weight of 638.76 g/mol. Its IUPAC name is bis[(3S,4R)-3-methoxy-4-[[(1R)-1-phenylethyl]amino]piperidine-1-carbonyl] butanedioate.
| Compound Name | bis[(3S,4R)-3-methoxy-4-[[(1R)-1-phenylethyl]amino]piperidine-1-carbonyl] butanedioate |
|---|---|
| PubChem CID | 135283675 |
| Molecular Formula | C34H46N4O8 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | bis[(3S,4R)-3-methoxy-4-[[(1R)-1-phenylethyl]amino]piperidine-1-carbonyl] butanedioate |
| SMILES | CO[C@H]1CN(C(=O)OC(=O)CCC(=O)OC(=O)N2CC[C@@H](N[C@H](C)c3ccccc3)[C@@H](OC)C2)CC[C@H]1N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C34H46N4O8/c1-23(25-11-7-5-8-12-25)35-27-17-19-37(21-29(27)43-3)33(41)45-31(39)15-16-32(40)46-34(42)38-20-18-28(30(22-38)44-4)36-24(2)26-13-9-6-10-14-26/h5-14,23-24,27-30,35-36H,15-22H2,1-4H3/t23-,24-,27-,28-,29+,30+/m1/s1 |
| InChIKey | LNFNXCAXSNAHLL-ZQBHYASFSA-N |
| XLogP | 3.97 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|