C16H25BN2O3 — CID 91490093
[(3S,4S)-3-ethoxycarbonyl-4-[[(1S)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid (PubChem CID 91490093) has the molecular formula C16H25BN2O3 and a molecular weight of 304.20 g/mol. Its IUPAC name is [(3S,4S)-3-ethoxycarbonyl-4-[[(1S)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid.
| Compound Name | [(3S,4S)-3-ethoxycarbonyl-4-[[(1S)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 91490093 |
| Molecular Formula | C16H25BN2O3 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [(3S,4S)-3-ethoxycarbonyl-4-[[(1S)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid |
| SMILES | CCOC(=O)[C@H]1CN(B(C)O)C[C@H]1N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H25BN2O3/c1-4-22-16(20)14-10-19(17(3)21)11-15(14)18-12(2)13-8-6-5-7-9-13/h5-9,12,14-15,18,21H,4,10-11H2,1-3H3/t12-,14-,15+/m0/s1 |
| InChIKey | UBGMPHOZIANZEX-AEGPPILISA-N |
| XLogP | 1.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|