About [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid
[(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid (PubChem CID 59091298) has the molecular formula C11H23BN2O3
and a molecular weight of 242.13 g/mol. Its IUPAC name is [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid.
Molecular Properties
| Compound Name | [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid |
| PubChem CID | 59091298 |
| Molecular Formula | C11H23BN2O3 |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid |
| SMILES | CCOC(=O)[C@@H]1CN(B(C)O)C[C@H]1NC(C)C |
| InChI | InChI=1S/C11H23BN2O3/c1-5-17-11(15)9-6-14(12(4)16)7-10(9)13-8(2)3/h8-10,13,16H,5-7H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | VWXBNIUBBSUEJR-NXEZZACHSA-N |
| XLogP | -0.04 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid?
The IUPAC name of [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid (CID 59091298) is [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid.
What is the SMILES notation for [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid?
The canonical SMILES for [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid is CCOC(=O)[C@@H]1CN(B(C)O)C[C@H]1NC(C)C.
What is the InChIKey of [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid?
The InChIKey is VWXBNIUBBSUEJR-NXEZZACHSA-N. The full InChI is InChI=1S/C11H23BN2O3/c1-5-17-11(15)9-6-14(12(4)16)7-10(9)13-8(2)3/h8-10,13,16H,5-7H2,1-4H3/t9-,10-/m1/s1.
What are the key properties of [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid?
[(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid has a molecular weight of 242.13 g/mol, XLogP of -0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid is sourced from PubChem (CID 59091298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).