C11H23BN2O3 — CID 59091298
[(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid (PubChem CID 59091298) has the molecular formula C11H23BN2O3 and a molecular weight of 242.13 g/mol. Its IUPAC name is [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid.
| Compound Name | [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59091298 |
| Molecular Formula | C11H23BN2O3 |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | [(3R,4S)-3-ethoxycarbonyl-4-(propan-2-ylamino)pyrrolidin-1-yl]-methylborinic acid |
| SMILES | CCOC(=O)[C@@H]1CN(B(C)O)C[C@H]1NC(C)C |
| InChI | InChI=1S/C11H23BN2O3/c1-5-17-11(15)9-6-14(12(4)16)7-10(9)13-8(2)3/h8-10,13,16H,5-7H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | VWXBNIUBBSUEJR-NXEZZACHSA-N |
| XLogP | -0.04 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|