C9H18BNO3 — CID 59091270
[(3S,4S)-3-ethoxycarbonyl-4-methylpyrrolidin-1-yl]-methylborinic acid (PubChem CID 59091270) has the molecular formula C9H18BNO3 and a molecular weight of 199.06 g/mol. Its IUPAC name is [(3S,4S)-3-ethoxycarbonyl-4-methylpyrrolidin-1-yl]-methylborinic acid.
| Compound Name | [(3S,4S)-3-ethoxycarbonyl-4-methylpyrrolidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59091270 |
| Molecular Formula | C9H18BNO3 |
| Molecular Weight | 199.06 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | [(3S,4S)-3-ethoxycarbonyl-4-methylpyrrolidin-1-yl]-methylborinic acid |
| SMILES | CCOC(=O)[C@@H]1CN(B(C)O)C[C@H]1C |
| InChI | InChI=1S/C9H18BNO3/c1-4-14-9(12)8-6-11(10(3)13)5-7(8)2/h7-8,13H,4-6H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | UXLDGGZRKDUKFK-HTQZYQBOSA-N |
| XLogP | 0.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.06 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|