About [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid
[(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid (PubChem CID 59016650) has the molecular formula C16H24BN2O3+
and a molecular weight of 303.19 g/mol. Its IUPAC name is [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid.
Molecular Properties
| Compound Name | [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid |
| PubChem CID | 59016650 |
| Molecular Formula | C16H24BN2O3+ |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid |
| SMILES | [CH2+]COC(=O)[C@H]1CN(B(C)O)C[C@@H]1N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H24BN2O3/c1-4-22-16(20)14-10-19(17(3)21)11-15(14)18-12(2)13-8-6-5-7-9-13/h5-9,12,14-15,18,21H,1,4,10-11H2,2-3H3/q+1/t12-,14+,15+/m1/s1 |
| InChIKey | HLUMQZQMNHRUNF-SNPRPXQTSA-N |
| XLogP | 1.13 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid?
The IUPAC name of [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid (CID 59016650) is [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid.
What is the SMILES notation for [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid?
The canonical SMILES for [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid is [CH2+]COC(=O)[C@H]1CN(B(C)O)C[C@@H]1N[C@H](C)c1ccccc1.
What is the InChIKey of [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid?
The InChIKey is HLUMQZQMNHRUNF-SNPRPXQTSA-N. The full InChI is InChI=1S/C16H24BN2O3/c1-4-22-16(20)14-10-19(17(3)21)11-15(14)18-12(2)13-8-6-5-7-9-13/h5-9,12,14-15,18,21H,1,4,10-11H2,2-3H3/q+1/t12-,14+,15+/m1/s1.
What are the key properties of [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid?
[(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid has a molecular weight of 303.19 g/mol, XLogP of 1.13, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-3-ethoxycarbonyl-4-[[(1R)-1-phenylethyl]amino]pyrrolidin-1-yl]-methylborinic acid is sourced from PubChem (CID 59016650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).