C15H22N2O3 — CID 175031310
[(1R,3R,4R)-3-hydroxy-4-(1-phenylethylamino)cyclohexyl] carbamate (PubChem CID 175031310) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is [(1R,3R,4R)-3-hydroxy-4-(1-phenylethylamino)cyclohexyl] carbamate.
| Compound Name | [(1R,3R,4R)-3-hydroxy-4-(1-phenylethylamino)cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175031310 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [(1R,3R,4R)-3-hydroxy-4-(1-phenylethylamino)cyclohexyl] carbamate |
| SMILES | CC(N[C@@H]1CC[C@@H](OC(N)=O)C[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O3/c1-10(11-5-3-2-4-6-11)17-13-8-7-12(9-14(13)18)20-15(16)19/h2-6,10,12-14,17-18H,7-9H2,1H3,(H2,16,19)/t10?,12-,13-,14-/m1/s1 |
| InChIKey | MZWJPWFCSGMGLG-FYFXECOGSA-N |
| XLogP | 1.71 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |