C29H38O4Si — CID 10254506
[(1R,2R,6S,7S,8R)-7,8-bis(phenylmethoxy)-3-oxatricyclo[4.3.0.02,4]non-4-en-5-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10254506) has the molecular formula C29H38O4Si and a molecular weight of 478.71 g/mol. Its IUPAC name is [(1R,2R,6S,7S,8R)-7,8-bis(phenylmethoxy)-3-oxatricyclo[4.3.0.02,4]non-4-en-5-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R,6S,7S,8R)-7,8-bis(phenylmethoxy)-3-oxatricyclo[4.3.0.02,4]non-4-en-5-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10254506 |
| Molecular Formula | C29H38O4Si |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | [(1R,2R,6S,7S,8R)-7,8-bis(phenylmethoxy)-3-oxatricyclo[4.3.0.02,4]non-4-en-5-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C2O[C@@H]2[C@@H]2C[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C29H38O4Si/c1-29(2,3)34(4,5)32-19-23-25-22(26-27(23)33-26)16-24(30-17-20-12-8-6-9-13-20)28(25)31-18-21-14-10-7-11-15-21/h6-15,22,24-26,28H,16-19H2,1-5H3/t22-,24-,25+,26-,28-/m1/s1 |
| InChIKey | LGAAHCMMGXCPOF-HOZVGSINSA-N |
| XLogP | 6.48 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|