C20H29N3O2 — CID 139041836
tert-butyl (3aS,6R,6aR)-3a,6-dimethyl-5-[(1R)-1-phenylethyl]-4,6-dihydro-3H-pyrrolo[3,4-c]pyrazole-6a-carboxylate (PubChem CID 139041836) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl (3aS,6R,6aR)-3a,6-dimethyl-5-[(1R)-1-phenylethyl]-4,6-dihydro-3H-pyrrolo[3,4-c]pyrazole-6a-carboxylate.
| Compound Name | tert-butyl (3aS,6R,6aR)-3a,6-dimethyl-5-[(1R)-1-phenylethyl]-4,6-dihydro-3H-pyrrolo[3,4-c]pyrazole-6a-carboxylate |
|---|---|
| PubChem CID | 139041836 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | tert-butyl (3aS,6R,6aR)-3a,6-dimethyl-5-[(1R)-1-phenylethyl]-4,6-dihydro-3H-pyrrolo[3,4-c]pyrazole-6a-carboxylate |
| SMILES | C[C@H](c1ccccc1)N1C[C@@]2(C)CN=N[C@@]2(C(=O)OC(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C20H29N3O2/c1-14(16-10-8-7-9-11-16)23-13-19(6)12-21-22-20(19,15(23)2)17(24)25-18(3,4)5/h7-11,14-15H,12-13H2,1-6H3/t14-,15-,19-,20-/m1/s1 |
| InChIKey | PJFFXHLTHFSDJC-PBGAUENZSA-N |
| XLogP | 4.00 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |