C28H35NO5Si — CID 135016292
[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl] pyrrole-1-carboxylate (PubChem CID 135016292) has the molecular formula C28H35NO5Si and a molecular weight of 493.68 g/mol. Its IUPAC name is [(2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl] pyrrole-1-carboxylate.
| Compound Name | [(2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl] pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 135016292 |
| Molecular Formula | C28H35NO5Si |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | [(2R)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl] pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)n1cccc1 |
| InChI | InChI=1S/C28H35NO5Si/c1-27(2,3)34-25(30)24(33-26(31)29-19-13-14-20-29)21-32-35(28(4,5)6,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h7-20,24H,21H2,1-6H3/t24-/m1/s1 |
| InChIKey | FOYPEGIEKXABCF-XMMPIXPASA-N |
| XLogP | 4.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|