C21H28N2O4Si — CID 175494998
[3-[tert-butyl(diphenyl)silyl]oxy-1-(methylamino)-1-oxopropan-2-yl] carbamate (PubChem CID 175494998) has the molecular formula C21H28N2O4Si and a molecular weight of 400.55 g/mol. Its IUPAC name is [3-[tert-butyl(diphenyl)silyl]oxy-1-(methylamino)-1-oxopropan-2-yl] carbamate.
| Compound Name | [3-[tert-butyl(diphenyl)silyl]oxy-1-(methylamino)-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175494998 |
| Molecular Formula | C21H28N2O4Si |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [3-[tert-butyl(diphenyl)silyl]oxy-1-(methylamino)-1-oxopropan-2-yl] carbamate |
| SMILES | CNC(=O)C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(N)=O |
| InChI | InChI=1S/C21H28N2O4Si/c1-21(2,3)28(16-11-7-5-8-12-16,17-13-9-6-10-14-17)26-15-18(19(24)23-4)27-20(22)25/h5-14,18H,15H2,1-4H3,(H2,22,25)(H,23,24) |
| InChIKey | DIESYZKYMDTPCG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|