C27H30KNO3Si — CID 101000100
potassium (2S)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]aziridine-2-carboxylate (PubChem CID 101000100) has the molecular formula C27H30KNO3Si and a molecular weight of 483.73 g/mol. Its IUPAC name is potassium (2S)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]aziridine-2-carboxylate.
| Compound Name | potassium (2S)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 101000100 |
| Molecular Formula | C27H30KNO3Si |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | potassium (2S)-1-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]aziridine-2-carboxylate |
| SMILES | CC(C)(C)[Si](OC[C@@H](c1ccccc1)N1C[C@H]1C(=O)[O-])(c1ccccc1)c1ccccc1.[K+] |
| InChI | InChI=1S/C27H31NO3Si.K/c1-27(2,3)32(22-15-9-5-10-16-22,23-17-11-6-12-18-23)31-20-25(21-13-7-4-8-14-21)28-19-24(28)26(29)30;/h4-18,24-25H,19-20H2,1-3H3,(H,29,30);/q;+1/p-1/t24-,25-,28?;/m0./s1 |
| InChIKey | GPZMWRLKZDJSIV-ZXRUWXMCSA-M |
| XLogP | -0.26 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|