C25H28F3NO5Si — CID 11785467
methyl (2S,3S)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-ynoate (PubChem CID 11785467) has the molecular formula C25H28F3NO5Si and a molecular weight of 507.58 g/mol. Its IUPAC name is methyl (2S,3S)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-ynoate.
| Compound Name | methyl (2S,3S)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-ynoate |
|---|---|
| PubChem CID | 11785467 |
| Molecular Formula | C25H28F3NO5Si |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | methyl (2S,3S)-6-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-[(2,2,2-trifluoroacetyl)amino]hex-4-ynoate |
| SMILES | COC(=O)[C@@H](NC(=O)C(F)(F)F)[C@@H](O)C#CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H28F3NO5Si/c1-24(2,3)35(18-12-7-5-8-13-18,19-14-9-6-10-15-19)34-17-11-16-20(30)21(22(31)33-4)29-23(32)25(26,27)28/h5-10,12-15,20-21,30H,17H2,1-4H3,(H,29,32)/t20-,21-/m0/s1 |
| InChIKey | XOQFMIVVIONLMI-SFTDATJTSA-N |
| XLogP | 2.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|