C26H36O3Si — CID 10895162
10-[tert-butyl(diphenyl)silyl]oxydec-8-yne-1,7-diol (PubChem CID 10895162) has the molecular formula C26H36O3Si and a molecular weight of 424.66 g/mol. Its IUPAC name is 10-[tert-butyl(diphenyl)silyl]oxydec-8-yne-1,7-diol.
| Compound Name | 10-[tert-butyl(diphenyl)silyl]oxydec-8-yne-1,7-diol |
|---|---|
| PubChem CID | 10895162 |
| Molecular Formula | C26H36O3Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 10-[tert-butyl(diphenyl)silyl]oxydec-8-yne-1,7-diol |
| SMILES | CC(C)(C)[Si](OCC#CC(O)CCCCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H36O3Si/c1-26(2,3)30(24-17-9-6-10-18-24,25-19-11-7-12-20-25)29-22-14-16-23(28)15-8-4-5-13-21-27/h6-7,9-12,17-20,23,27-28H,4-5,8,13,15,21-22H2,1-3H3 |
| InChIKey | JSYPDQRPYJUMIA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|