C30H32N2O2Si — CID 71480761
4-[tert-butyl(diphenyl)silyl]oxy-1-(3-methyl-1-phenylpyrazol-4-yl)but-2-yn-1-ol (PubChem CID 71480761) has the molecular formula C30H32N2O2Si and a molecular weight of 480.68 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-1-(3-methyl-1-phenylpyrazol-4-yl)but-2-yn-1-ol.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-(3-methyl-1-phenylpyrazol-4-yl)but-2-yn-1-ol |
|---|---|
| PubChem CID | 71480761 |
| Molecular Formula | C30H32N2O2Si |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-(3-methyl-1-phenylpyrazol-4-yl)but-2-yn-1-ol |
| SMILES | Cc1nn(-c2ccccc2)cc1C(O)C#CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H32N2O2Si/c1-24-28(23-32(31-24)25-15-8-5-9-16-25)29(33)21-14-22-34-35(30(2,3)4,26-17-10-6-11-18-26)27-19-12-7-13-20-27/h5-13,15-20,23,29,33H,22H2,1-4H3 |
| InChIKey | UKECATRSOIMZKX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|