C20H24O4 — CID 11359377
(3R)-3-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-phenylpropanoic acid (PubChem CID 11359377) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3R)-3-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-phenylpropanoic acid.
| Compound Name | (3R)-3-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11359377 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (3R)-3-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-phenylpropanoic acid |
| SMILES | COc1c(C)c(C)c(OC)c([C@H](CC(=O)O)c2ccccc2)c1C |
| InChI | InChI=1S/C20H24O4/c1-12-13(2)20(24-5)18(14(3)19(12)23-4)16(11-17(21)22)15-9-7-6-8-10-15/h6-10,16H,11H2,1-5H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | OWENOXPPBQMYBG-MRXNPFEDSA-N |
| XLogP | 4.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |