C24H33NO4 — CID 14576271
[6-(2,5-dimethoxy-3,4,6-trimethylphenyl)-6-pyridin-3-ylhexyl] acetate (PubChem CID 14576271) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is [6-(2,5-dimethoxy-3,4,6-trimethylphenyl)-6-pyridin-3-ylhexyl] acetate.
| Compound Name | [6-(2,5-dimethoxy-3,4,6-trimethylphenyl)-6-pyridin-3-ylhexyl] acetate |
|---|---|
| PubChem CID | 14576271 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | [6-(2,5-dimethoxy-3,4,6-trimethylphenyl)-6-pyridin-3-ylhexyl] acetate |
| SMILES | COc1c(C)c(C)c(OC)c(C(CCCCCOC(C)=O)c2cccnc2)c1C |
| InChI | InChI=1S/C24H33NO4/c1-16-17(2)24(28-6)22(18(3)23(16)27-5)21(20-11-10-13-25-15-20)12-8-7-9-14-29-19(4)26/h10-11,13,15,21H,7-9,12,14H2,1-6H3 |
| InChIKey | QVCLEDYSYWSPHL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|