C17H20Cl2F3NO2 — CID 11079835
N-[(2R)-2-(2,6-dichlorophenyl)-2-[(3R)-3-methylhex-5-en-3-yl]oxyethyl]-2,2,2-trifluoroacetamide (PubChem CID 11079835) has the molecular formula C17H20Cl2F3NO2 and a molecular weight of 398.25 g/mol. Its IUPAC name is N-[(2R)-2-(2,6-dichlorophenyl)-2-[(3R)-3-methylhex-5-en-3-yl]oxyethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R)-2-(2,6-dichlorophenyl)-2-[(3R)-3-methylhex-5-en-3-yl]oxyethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11079835 |
| Molecular Formula | C17H20Cl2F3NO2 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[(2R)-2-(2,6-dichlorophenyl)-2-[(3R)-3-methylhex-5-en-3-yl]oxyethyl]-2,2,2-trifluoroacetamide |
| SMILES | C=CC[C@@](C)(CC)O[C@@H](CNC(=O)C(F)(F)F)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H20Cl2F3NO2/c1-4-9-16(3,5-2)25-13(10-23-15(24)17(20,21)22)14-11(18)7-6-8-12(14)19/h4,6-8,13H,1,5,9-10H2,2-3H3,(H,23,24)/t13-,16+/m0/s1 |
| InChIKey | YYCHDHHTYXBUPM-XJKSGUPXSA-N |
| XLogP | 5.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|