C13H16F3NO2 — CID 103730656
2-methyl-2-phenyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide (PubChem CID 103730656) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-methyl-2-phenyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide.
| Compound Name | 2-methyl-2-phenyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 103730656 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-methyl-2-phenyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
| SMILES | CC(C)(C(=O)NCC(O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H16F3NO2/c1-12(2,9-6-4-3-5-7-9)11(19)17-8-10(18)13(14,15)16/h3-7,10,18H,8H2,1-2H3,(H,17,19) |
| InChIKey | TVEGFFINZNWKRC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |