C16H23NO2 — CID 64991414
N-(3,3-dimethyl-2-oxobutyl)-2-methyl-2-phenylpropanamide (PubChem CID 64991414) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(3,3-dimethyl-2-oxobutyl)-2-methyl-2-phenylpropanamide.
| Compound Name | N-(3,3-dimethyl-2-oxobutyl)-2-methyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 64991414 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(3,3-dimethyl-2-oxobutyl)-2-methyl-2-phenylpropanamide |
| SMILES | CC(C)(C)C(=O)CNC(=O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-15(2,3)13(18)11-17-14(19)16(4,5)12-9-7-6-8-10-12/h6-10H,11H2,1-5H3,(H,17,19) |
| InChIKey | VVHSIVKTMPJZPL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |