C14H23NO2 — CID 168939873
N-benzyl-2-hydroxypentanamide;ethane (PubChem CID 168939873) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-benzyl-2-hydroxypentanamide;ethane.
| Compound Name | N-benzyl-2-hydroxypentanamide;ethane |
|---|---|
| PubChem CID | 168939873 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-benzyl-2-hydroxypentanamide;ethane |
| SMILES | CC.CCCC(O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C12H17NO2.C2H6/c1-2-6-11(14)12(15)13-9-10-7-4-3-5-8-10;1-2/h3-5,7-8,11,14H,2,6,9H2,1H3,(H,13,15);1-2H3 |
| InChIKey | MGHRQFORUZHVDL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |