C38H42N4O4 — CID 3942749
1-N,1-N,3-N,3-N-tetrabenzyl-2-propylpropane-1,1,3,3-tetracarboxamide (PubChem CID 3942749) has the molecular formula C38H42N4O4 and a molecular weight of 618.78 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrabenzyl-2-propylpropane-1,1,3,3-tetracarboxamide.
| Compound Name | 1-N,1-N,3-N,3-N-tetrabenzyl-2-propylpropane-1,1,3,3-tetracarboxamide |
|---|---|
| PubChem CID | 3942749 |
| Molecular Formula | C38H42N4O4 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrabenzyl-2-propylpropane-1,1,3,3-tetracarboxamide |
| SMILES | CCCC(C(C(=O)NCc1ccccc1)C(=O)NCc1ccccc1)C(C(=O)NCc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C38H42N4O4/c1-2-15-32(33(35(43)39-24-28-16-7-3-8-17-28)36(44)40-25-29-18-9-4-10-19-29)34(37(45)41-26-30-20-11-5-12-21-30)38(46)42-27-31-22-13-6-14-23-31/h3-14,16-23,32-34H,2,15,24-27H2,1H3,(H,39,43)(H,40,44)(H,41,45)(H,42,46) |
| InChIKey | XGJTXRZNHXXDOT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|