C17H21BrO4SSi — CID 11189582
dimethyl 2-(2-bromoprop-2-enyl)-2-[3-[dimethyl(thiophen-2-yl)silyl]prop-2-ynyl]propanedioate (PubChem CID 11189582) has the molecular formula C17H21BrO4SSi and a molecular weight of 429.41 g/mol. Its IUPAC name is dimethyl 2-(2-bromoprop-2-enyl)-2-[3-[dimethyl(thiophen-2-yl)silyl]prop-2-ynyl]propanedioate.
| Compound Name | dimethyl 2-(2-bromoprop-2-enyl)-2-[3-[dimethyl(thiophen-2-yl)silyl]prop-2-ynyl]propanedioate |
|---|---|
| PubChem CID | 11189582 |
| Molecular Formula | C17H21BrO4SSi |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | dimethyl 2-(2-bromoprop-2-enyl)-2-[3-[dimethyl(thiophen-2-yl)silyl]prop-2-ynyl]propanedioate |
| SMILES | C=C(Br)CC(CC#C[Si](C)(C)c1cccs1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H21BrO4SSi/c1-13(18)12-17(15(19)21-2,16(20)22-3)9-7-11-24(4,5)14-8-6-10-23-14/h6,8,10H,1,9,12H2,2-5H3 |
| InChIKey | HYSZLKNHXREYCJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|