C17H21BrO4 — CID 11394578
dimethyl 2-(2-bromoprop-2-enyl)-2-[3-(cyclohexen-1-yl)prop-2-ynyl]propanedioate (PubChem CID 11394578) has the molecular formula C17H21BrO4 and a molecular weight of 369.26 g/mol. Its IUPAC name is dimethyl 2-(2-bromoprop-2-enyl)-2-[3-(cyclohexen-1-yl)prop-2-ynyl]propanedioate.
| Compound Name | dimethyl 2-(2-bromoprop-2-enyl)-2-[3-(cyclohexen-1-yl)prop-2-ynyl]propanedioate |
|---|---|
| PubChem CID | 11394578 |
| Molecular Formula | C17H21BrO4 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | dimethyl 2-(2-bromoprop-2-enyl)-2-[3-(cyclohexen-1-yl)prop-2-ynyl]propanedioate |
| SMILES | C=C(Br)CC(CC#CC1=CCCCC1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H21BrO4/c1-13(18)12-17(15(19)21-2,16(20)22-3)11-7-10-14-8-5-4-6-9-14/h8H,1,4-6,9,11-12H2,2-3H3 |
| InChIKey | KBHRIRRIJSNQRI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|