C14H23BrO4 — CID 102398253
dimethyl 2-(2-bromoprop-2-enyl)-2-(3,3-dimethylbutyl)propanedioate (PubChem CID 102398253) has the molecular formula C14H23BrO4 and a molecular weight of 335.24 g/mol. Its IUPAC name is dimethyl 2-(2-bromoprop-2-enyl)-2-(3,3-dimethylbutyl)propanedioate.
| Compound Name | dimethyl 2-(2-bromoprop-2-enyl)-2-(3,3-dimethylbutyl)propanedioate |
|---|---|
| PubChem CID | 102398253 |
| Molecular Formula | C14H23BrO4 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | dimethyl 2-(2-bromoprop-2-enyl)-2-(3,3-dimethylbutyl)propanedioate |
| SMILES | C=C(Br)CC(CCC(C)(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H23BrO4/c1-10(15)9-14(11(16)18-5,12(17)19-6)8-7-13(2,3)4/h1,7-9H2,2-6H3 |
| InChIKey | XCRUZCYIXJYONY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|