C9H13BrO4 — CID 101367116
dimethyl 2-(2-bromo-1,1-dideuterioprop-2-enyl)-2-methylpropanedioate (PubChem CID 101367116) has the molecular formula C9H13BrO4 and a molecular weight of 267.12 g/mol. Its IUPAC name is dimethyl 2-(2-bromo-1,1-dideuterioprop-2-enyl)-2-methylpropanedioate.
| Compound Name | dimethyl 2-(2-bromo-1,1-dideuterioprop-2-enyl)-2-methylpropanedioate |
|---|---|
| PubChem CID | 101367116 |
| Molecular Formula | C9H13BrO4 |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | dimethyl 2-(2-bromo-1,1-dideuterioprop-2-enyl)-2-methylpropanedioate |
| SMILES | [2H]C([2H])(C(=C)Br)C(C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C9H13BrO4/c1-6(10)5-9(2,7(11)13-3)8(12)14-4/h1,5H2,2-4H3/i5D2 |
| InChIKey | XXDATWJZPMDHRV-BFWBPSQCSA-N |
| XLogP | 1.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|