1-ethynylcyclohexene;2-methylprop-2-enoic acid

C12H16O2 — CID 90218670

IUPAC1-ethynylcyclohexene;2-methylprop-2-enoic acid
SMILESC#CC1=CCCCC1.C=C(C)C(=O)O
InChIInChI=1S/C8H10.C4H6O2/c1-2-8-6-4-3-5-7-8;1-3(2)4(5)6/h1,6H,3-5,7H2;1H2,2H3,(H,5,6)
InChIKeyTWEHTCDQIBGXKW-UHFFFAOYSA-N
MW192.26 g/mol
LogP2.77
Rot. Bonds1

About 1-ethynylcyclohexene;2-methylprop-2-enoic acid

1-ethynylcyclohexene;2-methylprop-2-enoic acid (PubChem CID 90218670) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-ethynylcyclohexene;2-methylprop-2-enoic acid.

Molecular Properties

Compound Name1-ethynylcyclohexene;2-methylprop-2-enoic acid
PubChem CID90218670
Molecular FormulaC12H16O2
Molecular Weight192.26 g/mol
Exact Mass192.12
IUPAC Name1-ethynylcyclohexene;2-methylprop-2-enoic acid
SMILESC#CC1=CCCCC1.C=C(C)C(=O)O
InChIInChI=1S/C8H10.C4H6O2/c1-2-8-6-4-3-5-7-8;1-3(2)4(5)6/h1,6H,3-5,7H2;1H2,2H3,(H,5,6)
InChIKeyTWEHTCDQIBGXKW-UHFFFAOYSA-N
XLogP2.77
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.26
LogP ≤ 52.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 1-ethynylcyclohexene;2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethynylcyclohexene;2-methylprop-2-enoic acid?
The IUPAC name of 1-ethynylcyclohexene;2-methylprop-2-enoic acid (CID 90218670) is 1-ethynylcyclohexene;2-methylprop-2-enoic acid.
What is the SMILES notation for 1-ethynylcyclohexene;2-methylprop-2-enoic acid?
The canonical SMILES for 1-ethynylcyclohexene;2-methylprop-2-enoic acid is C#CC1=CCCCC1.C=C(C)C(=O)O.
What is the InChIKey of 1-ethynylcyclohexene;2-methylprop-2-enoic acid?
The InChIKey is TWEHTCDQIBGXKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C4H6O2/c1-2-8-6-4-3-5-7-8;1-3(2)4(5)6/h1,6H,3-5,7H2;1H2,2H3,(H,5,6).
What are the key properties of 1-ethynylcyclohexene;2-methylprop-2-enoic acid?
1-ethynylcyclohexene;2-methylprop-2-enoic acid has a molecular weight of 192.26 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynylcyclohexene;2-methylprop-2-enoic acid is sourced from PubChem (CID 90218670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).